C11H13N5S2 — CID 80511340
3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridazine-4-carbothioamide (PubChem CID 80511340) has the molecular formula C11H13N5S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridazine-4-carbothioamide.
| Compound Name | 3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511340 |
| Molecular Formula | C11H13N5S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridazine-4-carbothioamide |
| SMILES | Cc1nc(CN(C)c2nnccc2C(N)=S)cs1 |
| InChI | InChI=1S/C11H13N5S2/c1-7-14-8(6-18-7)5-16(2)11-9(10(12)17)3-4-13-15-11/h3-4,6H,5H2,1-2H3,(H2,12,17) |
| InChIKey | ZDTZSZUNSUHZCN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|