C12H14N4S2 — CID 114288408
3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridine-4-carbothioamide (PubChem CID 114288408) has the molecular formula C12H14N4S2 and a molecular weight of 278.41 g/mol. Its IUPAC name is 3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridine-4-carbothioamide.
| Compound Name | 3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114288408 |
| Molecular Formula | C12H14N4S2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pyridine-4-carbothioamide |
| SMILES | Cc1nc(CN(C)c2cnccc2C(N)=S)cs1 |
| InChI | InChI=1S/C12H14N4S2/c1-8-15-9(7-18-8)6-16(2)11-5-14-4-3-10(11)12(13)17/h3-5,7H,6H2,1-2H3,(H2,13,17) |
| InChIKey | LADUXPFPZYKWKI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|