C15H15ClN2O2S — CID 80515465
3-(3-chlorophenyl)sulfanyl-5,6-diethylpyridazine-4-carboxylic acid (PubChem CID 80515465) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfanyl-5,6-diethylpyridazine-4-carboxylic acid.
| Compound Name | 3-(3-chlorophenyl)sulfanyl-5,6-diethylpyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 80515465 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-(3-chlorophenyl)sulfanyl-5,6-diethylpyridazine-4-carboxylic acid |
| SMILES | CCc1nnc(Sc2cccc(Cl)c2)c(C(=O)O)c1CC |
| InChI | InChI=1S/C15H15ClN2O2S/c1-3-11-12(4-2)17-18-14(13(11)15(19)20)21-10-7-5-6-9(16)8-10/h5-8H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | BEPPYWYZAMUUOC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |