C12H21N3O4S — CID 80519686
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-oxoazepan-3-yl)acetamide (PubChem CID 80519686) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-oxoazepan-3-yl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-oxoazepan-3-yl)acetamide |
|---|---|
| PubChem CID | 80519686 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-oxoazepan-3-yl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)NC1CCCCNC1=O |
| InChI | InChI=1S/C12H21N3O4S/c16-11(7-9-8-20(18,19)6-5-13-9)15-10-3-1-2-4-14-12(10)17/h9-10,13H,1-8H2,(H,14,17)(H,15,16) |
| InChIKey | IYIQXAOPFZBJHT-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |