C8H15F3N2O2S — CID 80522119
N-[2-(1,1-dioxo-1,4-thiazinan-3-yl)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 80522119) has the molecular formula C8H15F3N2O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-3-yl)ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-3-yl)ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 80522119 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-3-yl)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | O=S1(=O)CCNC(CCNCC(F)(F)F)C1 |
| InChI | InChI=1S/C8H15F3N2O2S/c9-8(10,11)6-12-2-1-7-5-16(14,15)4-3-13-7/h7,12-13H,1-6H2 |
| InChIKey | SHFFGHSEZQRHSX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|