C16H14N2O3 — CID 80523894
3-(2,4-dimethoxyphenyl)-3-oxo-2-pyridin-4-ylpropanenitrile (PubChem CID 80523894) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3-oxo-2-pyridin-4-ylpropanenitrile.
| Compound Name | 3-(2,4-dimethoxyphenyl)-3-oxo-2-pyridin-4-ylpropanenitrile |
|---|---|
| PubChem CID | 80523894 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-3-oxo-2-pyridin-4-ylpropanenitrile |
| SMILES | COc1ccc(C(=O)C(C#N)c2ccncc2)c(OC)c1 |
| InChI | InChI=1S/C16H14N2O3/c1-20-12-3-4-13(15(9-12)21-2)16(19)14(10-17)11-5-7-18-8-6-11/h3-9,14H,1-2H3 |
| InChIKey | XTDFMPNWVZNAPM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |