C15H18N2O3S — CID 80524381
1-[2-[(2-methyl-2-thiophen-2-ylpropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 80524381) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[2-[(2-methyl-2-thiophen-2-ylpropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[(2-methyl-2-thiophen-2-ylpropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 80524381 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[2-[(2-methyl-2-thiophen-2-ylpropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | CC(C)(CNC(=O)Cn1cccc1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C15H18N2O3S/c1-15(2,12-6-4-8-21-12)10-16-13(18)9-17-7-3-5-11(17)14(19)20/h3-8H,9-10H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | PZIHNXCFGRZYMB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |