C16H23NS2 — CID 80525978
N-[1-(5-ethylthiophen-2-yl)ethyl]-2-methyl-2-thiophen-2-ylpropan-1-amine (PubChem CID 80525978) has the molecular formula C16H23NS2 and a molecular weight of 293.50 g/mol. Its IUPAC name is N-[1-(5-ethylthiophen-2-yl)ethyl]-2-methyl-2-thiophen-2-ylpropan-1-amine.
| Compound Name | N-[1-(5-ethylthiophen-2-yl)ethyl]-2-methyl-2-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 80525978 |
| Molecular Formula | C16H23NS2 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[1-(5-ethylthiophen-2-yl)ethyl]-2-methyl-2-thiophen-2-ylpropan-1-amine |
| SMILES | CCc1ccc(C(C)NCC(C)(C)c2cccs2)s1 |
| InChI | InChI=1S/C16H23NS2/c1-5-13-8-9-14(19-13)12(2)17-11-16(3,4)15-7-6-10-18-15/h6-10,12,17H,5,11H2,1-4H3 |
| InChIKey | UOXZMPNSLOEMAY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |