C14H23NO2S2 — CID 80526208
2-methylsulfonyl-N-(2-methyl-2-thiophen-2-ylpropyl)cyclopentan-1-amine (PubChem CID 80526208) has the molecular formula C14H23NO2S2 and a molecular weight of 301.48 g/mol. Its IUPAC name is 2-methylsulfonyl-N-(2-methyl-2-thiophen-2-ylpropyl)cyclopentan-1-amine.
| Compound Name | 2-methylsulfonyl-N-(2-methyl-2-thiophen-2-ylpropyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 80526208 |
| Molecular Formula | C14H23NO2S2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-methylsulfonyl-N-(2-methyl-2-thiophen-2-ylpropyl)cyclopentan-1-amine |
| SMILES | CC(C)(CNC1CCCC1S(C)(=O)=O)c1cccs1 |
| InChI | InChI=1S/C14H23NO2S2/c1-14(2,13-8-5-9-18-13)10-15-11-6-4-7-12(11)19(3,16)17/h5,8-9,11-12,15H,4,6-7,10H2,1-3H3 |
| InChIKey | JXSYAKQAYRTIPV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |