C10H19N3O2S — CID 80527849
N-carbamoyl-2-[(2-methylthiolan-2-yl)methylamino]propanamide (PubChem CID 80527849) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is N-carbamoyl-2-[(2-methylthiolan-2-yl)methylamino]propanamide.
| Compound Name | N-carbamoyl-2-[(2-methylthiolan-2-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 80527849 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-carbamoyl-2-[(2-methylthiolan-2-yl)methylamino]propanamide |
| SMILES | CC(NCC1(C)CCCS1)C(=O)NC(N)=O |
| InChI | InChI=1S/C10H19N3O2S/c1-7(8(14)13-9(11)15)12-6-10(2)4-3-5-16-10/h7,12H,3-6H2,1-2H3,(H3,11,13,14,15) |
| InChIKey | YHMNOUSBKYYLTR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |