C10H14BrClN2OS — CID 80532114
4-amino-4-(5-bromo-4-chlorothiophen-2-yl)-2,2-dimethylbutanamide (PubChem CID 80532114) has the molecular formula C10H14BrClN2OS and a molecular weight of 325.66 g/mol. Its IUPAC name is 4-amino-4-(5-bromo-4-chlorothiophen-2-yl)-2,2-dimethylbutanamide.
| Compound Name | 4-amino-4-(5-bromo-4-chlorothiophen-2-yl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 80532114 |
| Molecular Formula | C10H14BrClN2OS |
| Molecular Weight | 325.66 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 4-amino-4-(5-bromo-4-chlorothiophen-2-yl)-2,2-dimethylbutanamide |
| SMILES | CC(C)(CC(N)c1cc(Cl)c(Br)s1)C(N)=O |
| InChI | InChI=1S/C10H14BrClN2OS/c1-10(2,9(14)15)4-6(13)7-3-5(12)8(11)16-7/h3,6H,4,13H2,1-2H3,(H2,14,15) |
| InChIKey | GDHGUUCHDWXALR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |