C14H11Br2N3OS — CID 80534161
5-(4,5-dibromothiophen-2-yl)-4-(3-methoxyphenyl)-1H-pyrazol-3-amine (PubChem CID 80534161) has the molecular formula C14H11Br2N3OS and a molecular weight of 429.14 g/mol. Its IUPAC name is 5-(4,5-dibromothiophen-2-yl)-4-(3-methoxyphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(4,5-dibromothiophen-2-yl)-4-(3-methoxyphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 80534161 |
| Molecular Formula | C14H11Br2N3OS |
| Molecular Weight | 429.14 g/mol |
| Exact Mass | 426.90 |
| IUPAC Name | 5-(4,5-dibromothiophen-2-yl)-4-(3-methoxyphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1cccc(-c2c(N)n[nH]c2-c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C14H11Br2N3OS/c1-20-8-4-2-3-7(5-8)11-12(18-19-14(11)17)10-6-9(15)13(16)21-10/h2-6H,1H3,(H3,17,18,19) |
| InChIKey | PROCFPICWGNVME-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.14 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |