C10H12Br2O2S — CID 80535369
(4,5-dibromothiophen-2-yl)-(oxan-3-yl)methanol (PubChem CID 80535369) has the molecular formula C10H12Br2O2S and a molecular weight of 356.08 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(oxan-3-yl)methanol.
| Compound Name | (4,5-dibromothiophen-2-yl)-(oxan-3-yl)methanol |
|---|---|
| PubChem CID | 80535369 |
| Molecular Formula | C10H12Br2O2S |
| Molecular Weight | 356.08 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(oxan-3-yl)methanol |
| SMILES | OC(c1cc(Br)c(Br)s1)C1CCCOC1 |
| InChI | InChI=1S/C10H12Br2O2S/c11-7-4-8(15-10(7)12)9(13)6-2-1-3-14-5-6/h4,6,9,13H,1-3,5H2 |
| InChIKey | HANGNMVGNITPIP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.08 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |