C13H12BrNO3S — CID 80537146
(2-amino-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanone (PubChem CID 80537146) has the molecular formula C13H12BrNO3S and a molecular weight of 342.21 g/mol. Its IUPAC name is (2-amino-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanone.
| Compound Name | (2-amino-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 80537146 |
| Molecular Formula | C13H12BrNO3S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | (2-amino-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanone |
| SMILES | COc1cc(N)c(C(=O)c2sccc2Br)cc1OC |
| InChI | InChI=1S/C13H12BrNO3S/c1-17-10-5-7(9(15)6-11(10)18-2)12(16)13-8(14)3-4-19-13/h3-6H,15H2,1-2H3 |
| InChIKey | VXMSSDYYDMKFOJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|