C11H11Br2N3OS — CID 80538814
5-(4,5-dibromothiophen-2-yl)-3-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 80538814) has the molecular formula C11H11Br2N3OS and a molecular weight of 393.10 g/mol. Its IUPAC name is 5-(4,5-dibromothiophen-2-yl)-3-piperidin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4,5-dibromothiophen-2-yl)-3-piperidin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 80538814 |
| Molecular Formula | C11H11Br2N3OS |
| Molecular Weight | 393.10 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | 5-(4,5-dibromothiophen-2-yl)-3-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | Brc1cc(-c2nc(C3CCNCC3)no2)sc1Br |
| InChI | InChI=1S/C11H11Br2N3OS/c12-7-5-8(18-9(7)13)11-15-10(16-17-11)6-1-3-14-4-2-6/h5-6,14H,1-4H2 |
| InChIKey | VSHZZIYHGSMMRE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.10 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |