C10H20N2O4 — CID 80540820
4-(1-methoxypropan-2-ylcarbamoylamino)-2-methylbutanoic acid (PubChem CID 80540820) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-(1-methoxypropan-2-ylcarbamoylamino)-2-methylbutanoic acid.
| Compound Name | 4-(1-methoxypropan-2-ylcarbamoylamino)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80540820 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 4-(1-methoxypropan-2-ylcarbamoylamino)-2-methylbutanoic acid |
| SMILES | COCC(C)NC(=O)NCCC(C)C(=O)O |
| InChI | InChI=1S/C10H20N2O4/c1-7(9(13)14)4-5-11-10(15)12-8(2)6-16-3/h7-8H,4-6H2,1-3H3,(H,13,14)(H2,11,12,15) |
| InChIKey | MNQGUYPUTFATGK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |