4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid

C12H24N2O3 — CID 104829285

IUPAC4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid
SMILESCC(CCNC(=O)NC(C)C(C)(C)C)C(=O)O
InChIInChI=1S/C12H24N2O3/c1-8(10(15)16)6-7-13-11(17)14-9(2)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,15,16)(H2,13,14,17)
InChIKeyKQPHXGBKFYGWMD-UHFFFAOYSA-N
MW244.33 g/mol
LogP1.83
Rot. Bonds5

About 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid

4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid (PubChem CID 104829285) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid.

Molecular Properties

Compound Name4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid
PubChem CID104829285
Molecular FormulaC12H24N2O3
Molecular Weight244.33 g/mol
Exact Mass244.18
IUPAC Name4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid
SMILESCC(CCNC(=O)NC(C)C(C)(C)C)C(=O)O
InChIInChI=1S/C12H24N2O3/c1-8(10(15)16)6-7-13-11(17)14-9(2)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,15,16)(H2,13,14,17)
InChIKeyKQPHXGBKFYGWMD-UHFFFAOYSA-N
XLogP1.83
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.33
LogP ≤ 51.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid?
The IUPAC name of 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid (CID 104829285) is 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid.
What is the SMILES notation for 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid?
The canonical SMILES for 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid is CC(CCNC(=O)NC(C)C(C)(C)C)C(=O)O.
What is the InChIKey of 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid?
The InChIKey is KQPHXGBKFYGWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-8(10(15)16)6-7-13-11(17)14-9(2)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,15,16)(H2,13,14,17).
What are the key properties of 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid?
4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid has a molecular weight of 244.33 g/mol, XLogP of 1.83, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-methylbutanoic acid is sourced from PubChem (CID 104829285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).