C11H23N3O3 — CID 80541974
4-[2-(dimethylamino)propylcarbamoylamino]-2-methylbutanoic acid (PubChem CID 80541974) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-[2-(dimethylamino)propylcarbamoylamino]-2-methylbutanoic acid.
| Compound Name | 4-[2-(dimethylamino)propylcarbamoylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80541974 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 4-[2-(dimethylamino)propylcarbamoylamino]-2-methylbutanoic acid |
| SMILES | CC(CCNC(=O)NCC(C)N(C)C)C(=O)O |
| InChI | InChI=1S/C11H23N3O3/c1-8(10(15)16)5-6-12-11(17)13-7-9(2)14(3)4/h8-9H,5-7H2,1-4H3,(H,15,16)(H2,12,13,17) |
| InChIKey | XHMXSTYNIDAJCM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |