C12H18N2O2 — CID 80546646
ethyl (E)-4-(3,4,5-trimethylpyrazol-1-yl)but-2-enoate (PubChem CID 80546646) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is ethyl (E)-4-(3,4,5-trimethylpyrazol-1-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(3,4,5-trimethylpyrazol-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 80546646 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | ethyl (E)-4-(3,4,5-trimethylpyrazol-1-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/Cn1nc(C)c(C)c1C |
| InChI | InChI=1S/C12H18N2O2/c1-5-16-12(15)7-6-8-14-11(4)9(2)10(3)13-14/h6-7H,5,8H2,1-4H3/b7-6+ |
| InChIKey | OUACACCBSZVOJH-VOTSOKGWSA-N |
| XLogP | 1.93 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|