C12H21NO2 — CID 80549043
ethyl (E)-4-(3,4-dimethylpyrrolidin-1-yl)but-2-enoate (PubChem CID 80549043) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is ethyl (E)-4-(3,4-dimethylpyrrolidin-1-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(3,4-dimethylpyrrolidin-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 80549043 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | ethyl (E)-4-(3,4-dimethylpyrrolidin-1-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN1CC(C)C(C)C1 |
| InChI | InChI=1S/C12H21NO2/c1-4-15-12(14)6-5-7-13-8-10(2)11(3)9-13/h5-6,10-11H,4,7-9H2,1-3H3/b6-5+ |
| InChIKey | UDSTWEQMFSDDOE-AATRIKPKSA-N |
| XLogP | 1.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|