C10H17NO4S — CID 80548894
ethyl (E)-4-(1,1-dioxo-1,4-thiazinan-4-yl)but-2-enoate (PubChem CID 80548894) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is ethyl (E)-4-(1,1-dioxo-1,4-thiazinan-4-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(1,1-dioxo-1,4-thiazinan-4-yl)but-2-enoate |
|---|---|
| PubChem CID | 80548894 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | ethyl (E)-4-(1,1-dioxo-1,4-thiazinan-4-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H17NO4S/c1-2-15-10(12)4-3-5-11-6-8-16(13,14)9-7-11/h3-4H,2,5-9H2,1H3/b4-3+ |
| InChIKey | NSPFJQWOAYVCDS-ONEGZZNKSA-N |
| XLogP | -0.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|