C17H29N3S — CID 80546975
1-[1-[1-(5-ethylthiophen-2-yl)ethyl]pyrrolidin-3-yl]piperidin-4-amine (PubChem CID 80546975) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is 1-[1-[1-(5-ethylthiophen-2-yl)ethyl]pyrrolidin-3-yl]piperidin-4-amine.
| Compound Name | 1-[1-[1-(5-ethylthiophen-2-yl)ethyl]pyrrolidin-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 80546975 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-[1-[1-(5-ethylthiophen-2-yl)ethyl]pyrrolidin-3-yl]piperidin-4-amine |
| SMILES | CCc1ccc(C(C)N2CCC(N3CCC(N)CC3)C2)s1 |
| InChI | InChI=1S/C17H29N3S/c1-3-16-4-5-17(21-16)13(2)20-11-8-15(12-20)19-9-6-14(18)7-10-19/h4-5,13-15H,3,6-12,18H2,1-2H3 |
| InChIKey | ZQBHYOXUZVOFQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |