C14H25N3S — CID 80505440
[1-[1-(5-ethylthiophen-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine (PubChem CID 80505440) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is [1-[1-(5-ethylthiophen-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine.
| Compound Name | [1-[1-(5-ethylthiophen-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine |
|---|---|
| PubChem CID | 80505440 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [1-[1-(5-ethylthiophen-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine |
| SMILES | CCc1ccc(C(C)N2CCN(C)CC2CN)s1 |
| InChI | InChI=1S/C14H25N3S/c1-4-13-5-6-14(18-13)11(2)17-8-7-16(3)10-12(17)9-15/h5-6,11-12H,4,7-10,15H2,1-3H3 |
| InChIKey | LDVNCNKXCCWHJN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |