C14H21BrClN3 — CID 82778837
[1-[1-(4-bromo-2-chlorophenyl)ethyl]-4-methylpiperazin-2-yl]methanamine (PubChem CID 82778837) has the molecular formula C14H21BrClN3 and a molecular weight of 346.70 g/mol. Its IUPAC name is [1-[1-(4-bromo-2-chlorophenyl)ethyl]-4-methylpiperazin-2-yl]methanamine.
| Compound Name | [1-[1-(4-bromo-2-chlorophenyl)ethyl]-4-methylpiperazin-2-yl]methanamine |
|---|---|
| PubChem CID | 82778837 |
| Molecular Formula | C14H21BrClN3 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [1-[1-(4-bromo-2-chlorophenyl)ethyl]-4-methylpiperazin-2-yl]methanamine |
| SMILES | CC(c1ccc(Br)cc1Cl)N1CCN(C)CC1CN |
| InChI | InChI=1S/C14H21BrClN3/c1-10(13-4-3-11(15)7-14(13)16)19-6-5-18(2)9-12(19)8-17/h3-4,7,10,12H,5-6,8-9,17H2,1-2H3 |
| InChIKey | VQEXZPAMVPKMBD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |