C12H20BrN3O — CID 113437671
[1-[1-(5-bromofuran-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine (PubChem CID 113437671) has the molecular formula C12H20BrN3O and a molecular weight of 302.22 g/mol. Its IUPAC name is [1-[1-(5-bromofuran-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine.
| Compound Name | [1-[1-(5-bromofuran-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine |
|---|---|
| PubChem CID | 113437671 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [1-[1-(5-bromofuran-2-yl)ethyl]-4-methylpiperazin-2-yl]methanamine |
| SMILES | CC(c1ccc(Br)o1)N1CCN(C)CC1CN |
| InChI | InChI=1S/C12H20BrN3O/c1-9(11-3-4-12(13)17-11)16-6-5-15(2)8-10(16)7-14/h3-4,9-10H,5-8,14H2,1-2H3 |
| InChIKey | QHHORYNMVKJZII-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |