C14H14N4O2 — CID 80548135
N-(3-nitro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-5-amine (PubChem CID 80548135) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(3-nitro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-5-amine.
| Compound Name | N-(3-nitro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-5-amine |
|---|---|
| PubChem CID | 80548135 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-(3-nitro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-5-amine |
| SMILES | O=[N+]([O-])c1cnccc1Nc1cccc2c1CCNC2 |
| InChI | InChI=1S/C14H14N4O2/c19-18(20)14-9-16-7-5-13(14)17-12-3-1-2-10-8-15-6-4-11(10)12/h1-3,5,7,9,15H,4,6,8H2,(H,16,17) |
| InChIKey | OSVXAUYYYJCPKR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|