C13H26N2O2 — CID 80549051
ethyl (E)-4-[(3-amino-2,2-dimethylpropyl)-ethylamino]but-2-enoate (PubChem CID 80549051) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is ethyl (E)-4-[(3-amino-2,2-dimethylpropyl)-ethylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[(3-amino-2,2-dimethylpropyl)-ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 80549051 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethyl (E)-4-[(3-amino-2,2-dimethylpropyl)-ethylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN(CC)CC(C)(C)CN |
| InChI | InChI=1S/C13H26N2O2/c1-5-15(11-13(3,4)10-14)9-7-8-12(16)17-6-2/h7-8H,5-6,9-11,14H2,1-4H3/b8-7+ |
| InChIKey | IHQBAERLCDNRIU-BQYQJAHWSA-N |
| XLogP | 1.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|