C11H19NO3 — CID 80549696
ethyl (E)-4-[2-(hydroxymethyl)pyrrolidin-1-yl]but-2-enoate (PubChem CID 80549696) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl (E)-4-[2-(hydroxymethyl)pyrrolidin-1-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[2-(hydroxymethyl)pyrrolidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 80549696 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | ethyl (E)-4-[2-(hydroxymethyl)pyrrolidin-1-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN1CCCC1CO |
| InChI | InChI=1S/C11H19NO3/c1-2-15-11(14)6-4-8-12-7-3-5-10(12)9-13/h4,6,10,13H,2-3,5,7-9H2,1H3/b6-4+ |
| InChIKey | WUANVBQFWNNFQD-GQCTYLIASA-N |
| XLogP | 0.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|