C6H8FN3O2 — CID 80551005
2-(1-aminoethyl)-5-fluoro-1H-pyrimidine-4,6-dione (PubChem CID 80551005) has the molecular formula C6H8FN3O2 and a molecular weight of 173.15 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-fluoro-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(1-aminoethyl)-5-fluoro-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 80551005 |
| Molecular Formula | C6H8FN3O2 |
| Molecular Weight | 173.15 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-(1-aminoethyl)-5-fluoro-1H-pyrimidine-4,6-dione |
| SMILES | CC(N)C1=NC(=O)C(F)C(=O)N1 |
| InChI | InChI=1S/C6H8FN3O2/c1-2(8)4-9-5(11)3(7)6(12)10-4/h2-3H,8H2,1H3,(H,9,10,11,12) |
| InChIKey | RGDIHSHSQSPTHV-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.15 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|