C14H19N5 — CID 80554281
N-(piperidin-3-ylmethyl)-6-pyrazol-1-ylpyridin-3-amine (PubChem CID 80554281) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-6-pyrazol-1-ylpyridin-3-amine.
| Compound Name | N-(piperidin-3-ylmethyl)-6-pyrazol-1-ylpyridin-3-amine |
|---|---|
| PubChem CID | 80554281 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-6-pyrazol-1-ylpyridin-3-amine |
| SMILES | c1cnn(-c2ccc(NCC3CCCNC3)cn2)c1 |
| InChI | InChI=1S/C14H19N5/c1-3-12(9-15-6-1)10-16-13-4-5-14(17-11-13)19-8-2-7-18-19/h2,4-5,7-8,11-12,15-16H,1,3,6,9-10H2 |
| InChIKey | WJMARIZILJNFEG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |