About (2-methoxy-2-oxoethyl) 4-hydroxybenzoate
(2-methoxy-2-oxoethyl) 4-hydroxybenzoate (PubChem CID 805551) has the molecular formula C10H10O5
and a molecular weight of 210.18 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 4-hydroxybenzoate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) 4-hydroxybenzoate |
| PubChem CID | 805551 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 4-hydroxybenzoate |
| SMILES | COC(=O)COC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H10O5/c1-14-9(12)6-15-10(13)7-2-4-8(11)5-3-7/h2-5,11H,6H2,1H3 |
| InChIKey | ROGHXCNLVCYVRF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methoxy-2-oxoethyl) 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) 4-hydroxybenzoate?
The IUPAC name of (2-methoxy-2-oxoethyl) 4-hydroxybenzoate (CID 805551) is (2-methoxy-2-oxoethyl) 4-hydroxybenzoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 4-hydroxybenzoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 4-hydroxybenzoate is COC(=O)COC(=O)c1ccc(O)cc1.
What is the InChIKey of (2-methoxy-2-oxoethyl) 4-hydroxybenzoate?
The InChIKey is ROGHXCNLVCYVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c1-14-9(12)6-15-10(13)7-2-4-8(11)5-3-7/h2-5,11H,6H2,1H3.
What are the key properties of (2-methoxy-2-oxoethyl) 4-hydroxybenzoate?
(2-methoxy-2-oxoethyl) 4-hydroxybenzoate has a molecular weight of 210.18 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 4-hydroxybenzoate is sourced from PubChem (CID 805551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).