C14H19N5O — CID 80556223
2-(4-aminophenyl)-N,2-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide (PubChem CID 80556223) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N,2-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide.
| Compound Name | 2-(4-aminophenyl)-N,2-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
|---|---|
| PubChem CID | 80556223 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-(4-aminophenyl)-N,2-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)C(C)(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H19N5O/c1-14(2,10-4-6-11(15)7-5-10)13(20)19(3)8-12-16-9-17-18-12/h4-7,9H,8,15H2,1-3H3,(H,16,17,18) |
| InChIKey | ILCZJPRIWWHXPO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|