C10H21N3 — CID 80559719
1-N-(2-pyrrolidin-1-ylethyl)cyclobutane-1,3-diamine (PubChem CID 80559719) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-N-(2-pyrrolidin-1-ylethyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(2-pyrrolidin-1-ylethyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80559719 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1-N-(2-pyrrolidin-1-ylethyl)cyclobutane-1,3-diamine |
| SMILES | NC1CC(NCCN2CCCC2)C1 |
| InChI | InChI=1S/C10H21N3/c11-9-7-10(8-9)12-3-6-13-4-1-2-5-13/h9-10,12H,1-8,11H2 |
| InChIKey | JSHMJTWXNOYKST-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |