C12H25N3 — CID 80560908
1-N-[2-(azepan-1-yl)ethyl]cyclobutane-1,3-diamine (PubChem CID 80560908) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-N-[2-(azepan-1-yl)ethyl]cyclobutane-1,3-diamine.
| Compound Name | 1-N-[2-(azepan-1-yl)ethyl]cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80560908 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-N-[2-(azepan-1-yl)ethyl]cyclobutane-1,3-diamine |
| SMILES | NC1CC(NCCN2CCCCCC2)C1 |
| InChI | InChI=1S/C12H25N3/c13-11-9-12(10-11)14-5-8-15-6-3-1-2-4-7-15/h11-12,14H,1-10,13H2 |
| InChIKey | ZGUISDWDQJIMFX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |