C9H18N2 — CID 80559737
1-N-(1-cyclopropylethyl)cyclobutane-1,3-diamine (PubChem CID 80559737) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-N-(1-cyclopropylethyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(1-cyclopropylethyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80559737 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-N-(1-cyclopropylethyl)cyclobutane-1,3-diamine |
| SMILES | CC(NC1CC(N)C1)C1CC1 |
| InChI | InChI=1S/C9H18N2/c1-6(7-2-3-7)11-9-4-8(10)5-9/h6-9,11H,2-5,10H2,1H3 |
| InChIKey | DHRIOJXANUKOGY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |