About 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine
1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine (PubChem CID 80561693) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine.
Analyze 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine?
The IUPAC name of 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine (CID 80561693) is 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine.
What is the SMILES notation for 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine?
The canonical SMILES for 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine is CCC(C)CN(C)C1CC(N)C1.
What is the InChIKey of 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine?
The InChIKey is QCWZVVYMQRCLBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-4-8(2)7-12(3)10-5-9(11)6-10/h8-10H,4-7,11H2,1-3H3.
What are the key properties of 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine?
1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine has a molecular weight of 170.30 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-1-N-(2-methylbutyl)cyclobutane-1,3-diamine is sourced from PubChem (CID 80561693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).