C12H26N2 — CID 166963473
(1S)-1-N'-cyclopropyl-1-N,1-N'-dimethyl-1-N-[(2S)-2-methylbutyl]ethane-1,1-diamine (PubChem CID 166963473) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (1S)-1-N'-cyclopropyl-1-N,1-N'-dimethyl-1-N-[(2S)-2-methylbutyl]ethane-1,1-diamine.
| Compound Name | (1S)-1-N'-cyclopropyl-1-N,1-N'-dimethyl-1-N-[(2S)-2-methylbutyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 166963473 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (1S)-1-N'-cyclopropyl-1-N,1-N'-dimethyl-1-N-[(2S)-2-methylbutyl]ethane-1,1-diamine |
| SMILES | CC[C@H](C)CN(C)[C@H](C)N(C)C1CC1 |
| InChI | InChI=1S/C12H26N2/c1-6-10(2)9-13(4)11(3)14(5)12-7-8-12/h10-12H,6-9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | ZDUVBBZXOFLIML-QWRGUYRKSA-N |
| XLogP | 2.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|