C8H15N3 — CID 80562417
3-[(3-aminocyclobutyl)amino]-2-methylpropanenitrile (PubChem CID 80562417) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-[(3-aminocyclobutyl)amino]-2-methylpropanenitrile.
| Compound Name | 3-[(3-aminocyclobutyl)amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 80562417 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3-[(3-aminocyclobutyl)amino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CNC1CC(N)C1 |
| InChI | InChI=1S/C8H15N3/c1-6(4-9)5-11-8-2-7(10)3-8/h6-8,11H,2-3,5,10H2,1H3 |
| InChIKey | WGWNDWNXNVFSLH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |