C12H22N2 — CID 80562396
1-N-(2,2-dicyclopropylethyl)cyclobutane-1,3-diamine (PubChem CID 80562396) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-N-(2,2-dicyclopropylethyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(2,2-dicyclopropylethyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80562396 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-N-(2,2-dicyclopropylethyl)cyclobutane-1,3-diamine |
| SMILES | NC1CC(NCC(C2CC2)C2CC2)C1 |
| InChI | InChI=1S/C12H22N2/c13-10-5-11(6-10)14-7-12(8-1-2-8)9-3-4-9/h8-12,14H,1-7,13H2 |
| InChIKey | JJBIOTCRRRJQHX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |