C13H24N2O — CID 66238347
4-[(2,2-dicyclopropylethylamino)methyl]oxolan-3-amine (PubChem CID 66238347) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 4-[(2,2-dicyclopropylethylamino)methyl]oxolan-3-amine.
| Compound Name | 4-[(2,2-dicyclopropylethylamino)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 66238347 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 4-[(2,2-dicyclopropylethylamino)methyl]oxolan-3-amine |
| SMILES | NC1COCC1CNCC(C1CC1)C1CC1 |
| InChI | InChI=1S/C13H24N2O/c14-13-8-16-7-11(13)5-15-6-12(9-1-2-9)10-3-4-10/h9-13,15H,1-8,14H2 |
| InChIKey | JYACRFCPVOBYRE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |