C10H16N2OS — CID 66238345
4-[(thiophen-3-ylmethylamino)methyl]oxolan-3-amine (PubChem CID 66238345) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 4-[(thiophen-3-ylmethylamino)methyl]oxolan-3-amine.
| Compound Name | 4-[(thiophen-3-ylmethylamino)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 66238345 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-[(thiophen-3-ylmethylamino)methyl]oxolan-3-amine |
| SMILES | NC1COCC1CNCc1ccsc1 |
| InChI | InChI=1S/C10H16N2OS/c11-10-6-13-5-9(10)4-12-3-8-1-2-14-7-8/h1-2,7,9-10,12H,3-6,11H2 |
| InChIKey | QQQITKITJJOMHD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |