C9H14N2S — CID 65460029
1-[(thiophen-3-ylmethylamino)methyl]cyclopropan-1-amine (PubChem CID 65460029) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 1-[(thiophen-3-ylmethylamino)methyl]cyclopropan-1-amine.
| Compound Name | 1-[(thiophen-3-ylmethylamino)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 65460029 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-[(thiophen-3-ylmethylamino)methyl]cyclopropan-1-amine |
| SMILES | NC1(CNCc2ccsc2)CC1 |
| InChI | InChI=1S/C9H14N2S/c10-9(2-3-9)7-11-5-8-1-4-12-6-8/h1,4,6,11H,2-3,5,7,10H2 |
| InChIKey | WPNZXUDVETVYMJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |