C11H18ClNS — CID 115680477
N-[(1-methylcyclobutyl)methyl]-1-thiophen-3-ylmethanamine;hydrochloride (PubChem CID 115680477) has the molecular formula C11H18ClNS and a molecular weight of 231.79 g/mol. Its IUPAC name is N-[(1-methylcyclobutyl)methyl]-1-thiophen-3-ylmethanamine;hydrochloride.
| Compound Name | N-[(1-methylcyclobutyl)methyl]-1-thiophen-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 115680477 |
| Molecular Formula | C11H18ClNS |
| Molecular Weight | 231.79 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-[(1-methylcyclobutyl)methyl]-1-thiophen-3-ylmethanamine;hydrochloride |
| SMILES | CC1(CNCc2ccsc2)CCC1.Cl |
| InChI | InChI=1S/C11H17NS.ClH/c1-11(4-2-5-11)9-12-7-10-3-6-13-8-10;/h3,6,8,12H,2,4-5,7,9H2,1H3;1H |
| InChIKey | GQBJNROSMOQCCX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |