C11H18ClN3 — CID 115680392
N-[(1-methylcyclobutyl)methyl]-1-pyrimidin-5-ylmethanamine;hydrochloride (PubChem CID 115680392) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N-[(1-methylcyclobutyl)methyl]-1-pyrimidin-5-ylmethanamine;hydrochloride.
| Compound Name | N-[(1-methylcyclobutyl)methyl]-1-pyrimidin-5-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 115680392 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-[(1-methylcyclobutyl)methyl]-1-pyrimidin-5-ylmethanamine;hydrochloride |
| SMILES | CC1(CNCc2cncnc2)CCC1.Cl |
| InChI | InChI=1S/C11H17N3.ClH/c1-11(3-2-4-11)8-12-5-10-6-13-9-14-7-10;/h6-7,9,12H,2-5,8H2,1H3;1H |
| InChIKey | AUOFMTZBITWJCL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |