C10H10F3NO — CID 80562806
5-amino-1-(trifluoromethyl)-2,3-dihydroinden-1-ol (PubChem CID 80562806) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 5-amino-1-(trifluoromethyl)-2,3-dihydroinden-1-ol.
| Compound Name | 5-amino-1-(trifluoromethyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 80562806 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-amino-1-(trifluoromethyl)-2,3-dihydroinden-1-ol |
| SMILES | Nc1ccc2c(c1)CCC2(O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO/c11-10(12,13)9(15)4-3-6-5-7(14)1-2-8(6)9/h1-2,5,15H,3-4,14H2 |
| InChIKey | XGHBORORZSUUGV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|