C13H17N3O2S — CID 80563212
5-cyano-2-methyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide (PubChem CID 80563212) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-cyano-2-methyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-cyano-2-methyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 80563212 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-cyano-2-methyl-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C#N)cc1S(=O)(=O)NCC1CCNC1 |
| InChI | InChI=1S/C13H17N3O2S/c1-10-2-3-11(7-14)6-13(10)19(17,18)16-9-12-4-5-15-8-12/h2-3,6,12,15-16H,4-5,8-9H2,1H3 |
| InChIKey | YQOWSXAVYWPRAV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |