C13H20N2O2 — CID 80564107
2-(pyrrolidin-3-ylmethyl)-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 80564107) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-(pyrrolidin-3-ylmethyl)-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-(pyrrolidin-3-ylmethyl)-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 80564107 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-(pyrrolidin-3-ylmethyl)-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCCC2)C(=O)N1CC1CCNC1 |
| InChI | InChI=1S/C13H20N2O2/c16-11-7-13(4-1-2-5-13)12(17)15(11)9-10-3-6-14-8-10/h10,14H,1-9H2 |
| InChIKey | JGAXSQPSGCIVRD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|