C13H22N2O2 — CID 114956274
3,3-dimethyl-1-[(4-methylpiperidin-3-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 114956274) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(4-methylpiperidin-3-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 3,3-dimethyl-1-[(4-methylpiperidin-3-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 114956274 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3,3-dimethyl-1-[(4-methylpiperidin-3-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | CC1CCNCC1CN1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C13H22N2O2/c1-9-4-5-14-7-10(9)8-15-11(16)6-13(2,3)12(15)17/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | HYCDLIXWRZDMOV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|