About 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine
4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine (PubChem CID 80567467) has the molecular formula C15H22N2S
and a molecular weight of 262.42 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine |
| PubChem CID | 80567467 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine |
| SMILES | CC1CN(CC2Cc3ccccc3N2)CC(C)S1 |
| InChI | InChI=1S/C15H22N2S/c1-11-8-17(9-12(2)18-11)10-14-7-13-5-3-4-6-15(13)16-14/h3-6,11-12,14,16H,7-10H2,1-2H3 |
| InChIKey | MIHZLCXFIKBZSG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine?
The IUPAC name of 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine (CID 80567467) is 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine.
What is the SMILES notation for 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine?
The canonical SMILES for 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine is CC1CN(CC2Cc3ccccc3N2)CC(C)S1.
What is the InChIKey of 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine?
The InChIKey is MIHZLCXFIKBZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2S/c1-11-8-17(9-12(2)18-11)10-14-7-13-5-3-4-6-15(13)16-14/h3-6,11-12,14,16H,7-10H2,1-2H3.
What are the key properties of 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine?
4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine has a molecular weight of 262.42 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1H-indol-2-ylmethyl)-2,6-dimethylthiomorpholine is sourced from PubChem (CID 80567467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).