C16H22N2O2S — CID 80569218
2-[(3,5-dimethyl-1-adamantyl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 80569218) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1-adamantyl)amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(3,5-dimethyl-1-adamantyl)amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 80569218 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[(3,5-dimethyl-1-adamantyl)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC12CC3CC(C)(C1)CC(Nc1nc(C(=O)O)cs1)(C3)C2 |
| InChI | InChI=1S/C16H22N2O2S/c1-14-3-10-4-15(2,7-14)9-16(5-10,8-14)18-13-17-11(6-21-13)12(19)20/h6,10H,3-5,7-9H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | PZBADNPOGYSBKO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |